| Name | 2-Acetyl-1-naphthol |
| Synonyms | TIMTEC-BB SBB010063 2-Acetyl-1-naphthol RARECHEM BW GA 0421 LABOTEST-BB LT00068557 Ethanone, 1-(1-Hydroxy-2- 1-Hydroxy-2-acetonaphthone l'-hydroxy-2'-acetonaphtone 2-Acetyl-1-hydroxynaphthalene methyl(1-hydroxy-2-naphthyl)ketone 2-hydroxy-1-(1-naphthalenyl)ethanone Ethanone, 1-(1-hydroxy-2-naphthalenyl)- |
| CAS | 711-79-5 |
| EINECS | 211-918-8 |
| InChI | InChI=1/C12H10O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-7,14H,1H3 |
| Molecular Formula | C12H10O2 |
| Molar Mass | 186.21 |
| Density | 1.1032 (rough estimate) |
| Melting Point | 98-100°C(lit.) |
| Boling Point | 280.69°C (rough estimate) |
| Flash Point | 142.4°C |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 6.37E-05mmHg at 25°C |
| Appearance | Crystalline Powder |
| Color | Yellow |
| BRN | 1868084 |
| pKa | pK1: 13.40 (30°C) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.6086 (estimate) |
| MDL | MFCD00003963 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29145000 |
| Hazard Class | IRRITANT |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |